C16H23FN4O2 — CID 134187435
tert-butyl N-[(2S)-3-[(5-cyano-3-fluoro-6-methyl-2-pyridinyl)amino]butan-2-yl]carbamate (PubChem CID 134187435) has the molecular formula C16H23FN4O2 and a molecular weight of 322.38 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-[(5-cyano-3-fluoro-6-methyl-2-pyridinyl)amino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-[(5-cyano-3-fluoro-6-methyl-2-pyridinyl)amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 134187435 |
| Molecular Formula | C16H23FN4O2 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | tert-butyl N-[(2S)-3-[(5-cyano-3-fluoro-6-methyl-2-pyridinyl)amino]butan-2-yl]carbamate |
| SMILES | Cc1nc(NC(C)[C@H](C)NC(=O)OC(C)(C)C)c(F)cc1C#N |
| InChI | InChI=1S/C16H23FN4O2/c1-9(10(2)21-15(22)23-16(4,5)6)19-14-13(17)7-12(8-18)11(3)20-14/h7,9-10H,1-6H3,(H,19,20)(H,21,22)/t9?,10-/m0/s1 |
| InChIKey | NDWNEHRRXZYABU-AXDSSHIGSA-N |
| XLogP | 3.11 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |