C11H15N3O3 — CID 130855846
tert-butyl N-[1-(4-cyano-1,2-oxazol-3-yl)ethyl]carbamate (PubChem CID 130855846) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is tert-butyl N-[1-(4-cyano-1,2-oxazol-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(4-cyano-1,2-oxazol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 130855846 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | tert-butyl N-[1-(4-cyano-1,2-oxazol-3-yl)ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1nocc1C#N |
| InChI | InChI=1S/C11H15N3O3/c1-7(9-8(5-12)6-16-14-9)13-10(15)17-11(2,3)4/h6-7H,1-4H3,(H,13,15) |
| InChIKey | UNWQZEBCRNQJQF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |