C17H23ClFN3O2 — CID 144524193
ethyl 3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]propanoate;methylcyclopentane (PubChem CID 144524193) has the molecular formula C17H23ClFN3O2 and a molecular weight of 355.84 g/mol. Its IUPAC name is ethyl 3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]propanoate;methylcyclopentane.
| Compound Name | ethyl 3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]propanoate;methylcyclopentane |
|---|---|
| PubChem CID | 144524193 |
| Molecular Formula | C17H23ClFN3O2 |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | ethyl 3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]propanoate;methylcyclopentane |
| SMILES | CC1CCCC1.CCOC(=O)CCNc1nc(Cl)c(C#N)cc1F |
| InChI | InChI=1S/C11H11ClFN3O2.C6H12/c1-2-18-9(17)3-4-15-11-8(13)5-7(6-14)10(12)16-11;1-6-4-2-3-5-6/h5H,2-4H2,1H3,(H,15,16);6H,2-5H2,1H3 |
| InChIKey | ZGZFYHZVEHBTGF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|