C10H13ClFN3O2 — CID 79076101
ethyl 4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]butanoate (PubChem CID 79076101) has the molecular formula C10H13ClFN3O2 and a molecular weight of 261.68 g/mol. Its IUPAC name is ethyl 4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]butanoate.
| Compound Name | ethyl 4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]butanoate |
|---|---|
| PubChem CID | 79076101 |
| Molecular Formula | C10H13ClFN3O2 |
| Molecular Weight | 261.68 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | ethyl 4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]butanoate |
| SMILES | CCOC(=O)CCCNc1nc(Cl)ncc1F |
| InChI | InChI=1S/C10H13ClFN3O2/c1-2-17-8(16)4-3-5-13-9-7(12)6-14-10(11)15-9/h6H,2-5H2,1H3,(H,13,14,15) |
| InChIKey | KFLZYNMKQLXIHD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.68 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|