C13H20ClFN4O2 — CID 156771314
ethyl 2-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]-(2,2-dimethylpropyl)amino]acetate (PubChem CID 156771314) has the molecular formula C13H20ClFN4O2 and a molecular weight of 318.78 g/mol. Its IUPAC name is ethyl 2-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]-(2,2-dimethylpropyl)amino]acetate.
| Compound Name | ethyl 2-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]-(2,2-dimethylpropyl)amino]acetate |
|---|---|
| PubChem CID | 156771314 |
| Molecular Formula | C13H20ClFN4O2 |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | ethyl 2-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]-(2,2-dimethylpropyl)amino]acetate |
| SMILES | CCOC(=O)CN(CC(C)(C)C)Nc1nc(Cl)ncc1F |
| InChI | InChI=1S/C13H20ClFN4O2/c1-5-21-10(20)7-19(8-13(2,3)4)18-11-9(15)6-16-12(14)17-11/h6H,5,7-8H2,1-4H3,(H,16,17,18) |
| InChIKey | MZHWOFPBYQCXEN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|