C12H18ClN3O2 — CID 64574900
ethyl 4-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]butanoate (PubChem CID 64574900) has the molecular formula C12H18ClN3O2 and a molecular weight of 271.75 g/mol. Its IUPAC name is ethyl 4-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]butanoate.
| Compound Name | ethyl 4-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]butanoate |
|---|---|
| PubChem CID | 64574900 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | ethyl 4-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]butanoate |
| SMILES | CCOC(=O)CCCNc1nc(C)nc(Cl)c1C |
| InChI | InChI=1S/C12H18ClN3O2/c1-4-18-10(17)6-5-7-14-12-8(2)11(13)15-9(3)16-12/h4-7H2,1-3H3,(H,14,15,16) |
| InChIKey | HNBSTXXZHIZSRB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|