C10H13ClN4O2 — CID 80732409
4-[(6-chloro-5-formyl-2-methylpyrimidin-4-yl)amino]butanamide (PubChem CID 80732409) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is 4-[(6-chloro-5-formyl-2-methylpyrimidin-4-yl)amino]butanamide.
| Compound Name | 4-[(6-chloro-5-formyl-2-methylpyrimidin-4-yl)amino]butanamide |
|---|---|
| PubChem CID | 80732409 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 4-[(6-chloro-5-formyl-2-methylpyrimidin-4-yl)amino]butanamide |
| SMILES | Cc1nc(Cl)c(C=O)c(NCCCC(N)=O)n1 |
| InChI | InChI=1S/C10H13ClN4O2/c1-6-14-9(11)7(5-16)10(15-6)13-4-2-3-8(12)17/h5H,2-4H2,1H3,(H2,12,17)(H,13,14,15) |
| InChIKey | VANWCKYXMZXDSU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|