C9H9ClF3N3OS — CID 114188159
4-chloro-2-methyl-6-[2-(trifluoromethylsulfanyl)ethylamino]pyrimidine-5-carbaldehyde (PubChem CID 114188159) has the molecular formula C9H9ClF3N3OS and a molecular weight of 299.71 g/mol. Its IUPAC name is 4-chloro-2-methyl-6-[2-(trifluoromethylsulfanyl)ethylamino]pyrimidine-5-carbaldehyde.
| Compound Name | 4-chloro-2-methyl-6-[2-(trifluoromethylsulfanyl)ethylamino]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 114188159 |
| Molecular Formula | C9H9ClF3N3OS |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 4-chloro-2-methyl-6-[2-(trifluoromethylsulfanyl)ethylamino]pyrimidine-5-carbaldehyde |
| SMILES | Cc1nc(Cl)c(C=O)c(NCCSC(F)(F)F)n1 |
| InChI | InChI=1S/C9H9ClF3N3OS/c1-5-15-7(10)6(4-17)8(16-5)14-2-3-18-9(11,12)13/h4H,2-3H2,1H3,(H,14,15,16) |
| InChIKey | OTHDBAYOUGUNLH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|