C9H11ClN4O2 — CID 80732228
3-[(6-chloro-5-formyl-2-methylpyrimidin-4-yl)amino]propanamide (PubChem CID 80732228) has the molecular formula C9H11ClN4O2 and a molecular weight of 242.67 g/mol. Its IUPAC name is 3-[(6-chloro-5-formyl-2-methylpyrimidin-4-yl)amino]propanamide.
| Compound Name | 3-[(6-chloro-5-formyl-2-methylpyrimidin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 80732228 |
| Molecular Formula | C9H11ClN4O2 |
| Molecular Weight | 242.67 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 3-[(6-chloro-5-formyl-2-methylpyrimidin-4-yl)amino]propanamide |
| SMILES | Cc1nc(Cl)c(C=O)c(NCCC(N)=O)n1 |
| InChI | InChI=1S/C9H11ClN4O2/c1-5-13-8(10)6(4-15)9(14-5)12-3-2-7(11)16/h4H,2-3H2,1H3,(H2,11,16)(H,12,13,14) |
| InChIKey | RJGXNTXPWXFCSU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.67 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|