C11H18ClN5O2 — CID 64574899
ethyl 4-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]butanoate (PubChem CID 64574899) has the molecular formula C11H18ClN5O2 and a molecular weight of 287.75 g/mol. Its IUPAC name is ethyl 4-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]butanoate.
| Compound Name | ethyl 4-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 64574899 |
| Molecular Formula | C11H18ClN5O2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | ethyl 4-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]butanoate |
| SMILES | CCOC(=O)CCCNc1nc(Cl)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H18ClN5O2/c1-4-19-8(18)6-5-7-13-10-14-9(12)15-11(16-10)17(2)3/h4-7H2,1-3H3,(H,13,14,15,16) |
| InChIKey | NEQNEUYZWRAEHT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|