ethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate

C10H15ClN4O3 — CID 62858556

IUPACethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate
SMILESCCOC(=O)CCNc1nc(Cl)nc(OCC)n1
InChIInChI=1S/C10H15ClN4O3/c1-3-17-7(16)5-6-12-9-13-8(11)14-10(15-9)18-4-2/h3-6H2,1-2H3,(H,12,13,14,15)
InChIKeyGXMYALHFOBDHEG-UHFFFAOYSA-N
MW274.71 g/mol
LogP1.29
Rot. Bonds7

About ethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate

ethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate (PubChem CID 62858556) has the molecular formula C10H15ClN4O3 and a molecular weight of 274.71 g/mol. Its IUPAC name is ethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate.

Molecular Properties

Compound Nameethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate
PubChem CID62858556
Molecular FormulaC10H15ClN4O3
Molecular Weight274.71 g/mol
Exact Mass274.08
IUPAC Nameethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate
SMILESCCOC(=O)CCNc1nc(Cl)nc(OCC)n1
InChIInChI=1S/C10H15ClN4O3/c1-3-17-7(16)5-6-12-9-13-8(11)14-10(15-9)18-4-2/h3-6H2,1-2H3,(H,12,13,14,15)
InChIKeyGXMYALHFOBDHEG-UHFFFAOYSA-N
XLogP1.29
TPSA86.23 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.71
LogP ≤ 51.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze ethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate?
The IUPAC name of ethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate (CID 62858556) is ethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate.
What is the SMILES notation for ethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate?
The canonical SMILES for ethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate is CCOC(=O)CCNc1nc(Cl)nc(OCC)n1.
What is the InChIKey of ethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate?
The InChIKey is GXMYALHFOBDHEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN4O3/c1-3-17-7(16)5-6-12-9-13-8(11)14-10(15-9)18-4-2/h3-6H2,1-2H3,(H,12,13,14,15).
What are the key properties of ethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate?
ethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate has a molecular weight of 274.71 g/mol, XLogP of 1.29, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]propanoate is sourced from PubChem (CID 62858556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).