C10H16ClN5O3 — CID 113405709
2-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-(2-methoxyethyl)acetamide (PubChem CID 113405709) has the molecular formula C10H16ClN5O3 and a molecular weight of 289.72 g/mol. Its IUPAC name is 2-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 113405709 |
| Molecular Formula | C10H16ClN5O3 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)amino]-N-(2-methoxyethyl)acetamide |
| SMILES | CCOc1nc(Cl)nc(NCC(=O)NCCOC)n1 |
| InChI | InChI=1S/C10H16ClN5O3/c1-3-19-10-15-8(11)14-9(16-10)13-6-7(17)12-4-5-18-2/h3-6H2,1-2H3,(H,12,17)(H,13,14,15,16) |
| InChIKey | JFXPBSJVXHUPSN-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|