C11H18ClN3 — CID 63730254
6-chloro-2,5-dimethyl-N-pentylpyrimidin-4-amine (PubChem CID 63730254) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is 6-chloro-2,5-dimethyl-N-pentylpyrimidin-4-amine.
| Compound Name | 6-chloro-2,5-dimethyl-N-pentylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63730254 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 6-chloro-2,5-dimethyl-N-pentylpyrimidin-4-amine |
| SMILES | CCCCCNc1nc(C)nc(Cl)c1C |
| InChI | InChI=1S/C11H18ClN3/c1-4-5-6-7-13-11-8(2)10(12)14-9(3)15-11/h4-7H2,1-3H3,(H,13,14,15) |
| InChIKey | SNTXMYVMMRIZJG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|