C9H14ClN3O — CID 63734406
6-chloro-N-(2-methoxyethyl)-2,5-dimethylpyrimidin-4-amine (PubChem CID 63734406) has the molecular formula C9H14ClN3O and a molecular weight of 215.68 g/mol. Its IUPAC name is 6-chloro-N-(2-methoxyethyl)-2,5-dimethylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-(2-methoxyethyl)-2,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63734406 |
| Molecular Formula | C9H14ClN3O |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 6-chloro-N-(2-methoxyethyl)-2,5-dimethylpyrimidin-4-amine |
| SMILES | COCCNc1nc(C)nc(Cl)c1C |
| InChI | InChI=1S/C9H14ClN3O/c1-6-8(10)12-7(2)13-9(6)11-4-5-14-3/h4-5H2,1-3H3,(H,11,12,13) |
| InChIKey | UVZJCTDSZSJFGL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|