C10H10ClN3 — CID 82611382
2-chloro-7-methyl-6,8-dihydro-5H-1,7-naphthyridine-3-carbonitrile (PubChem CID 82611382) has the molecular formula C10H10ClN3 and a molecular weight of 207.66 g/mol. Its IUPAC name is 2-chloro-7-methyl-6,8-dihydro-5H-1,7-naphthyridine-3-carbonitrile.
| Compound Name | 2-chloro-7-methyl-6,8-dihydro-5H-1,7-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 82611382 |
| Molecular Formula | C10H10ClN3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2-chloro-7-methyl-6,8-dihydro-5H-1,7-naphthyridine-3-carbonitrile |
| SMILES | CN1CCc2cc(C#N)c(Cl)nc2C1 |
| InChI | InChI=1S/C10H10ClN3/c1-14-3-2-7-4-8(5-12)10(11)13-9(7)6-14/h4H,2-3,6H2,1H3 |
| InChIKey | JCLXOUXASRBRIK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|