C8H4Cl2N2O — CID 167702733
5-acetyl-2,6-dichloropyridine-3-carbonitrile (PubChem CID 167702733) has the molecular formula C8H4Cl2N2O and a molecular weight of 215.04 g/mol. Its IUPAC name is 5-acetyl-2,6-dichloropyridine-3-carbonitrile.
| Compound Name | 5-acetyl-2,6-dichloropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 167702733 |
| Molecular Formula | C8H4Cl2N2O |
| Molecular Weight | 215.04 g/mol |
| Exact Mass | 213.97 |
| IUPAC Name | 5-acetyl-2,6-dichloropyridine-3-carbonitrile |
| SMILES | CC(=O)c1cc(C#N)c(Cl)nc1Cl |
| InChI | InChI=1S/C8H4Cl2N2O/c1-4(13)6-2-5(3-11)7(9)12-8(6)10/h2H,1H3 |
| InChIKey | FDKCISMWYKKBQN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.04 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|