About 6-chlorothieno[2,3-b]pyridine-5-carbonitrile
6-chlorothieno[2,3-b]pyridine-5-carbonitrile (PubChem CID 82400712) has the molecular formula C8H3ClN2S
and a molecular weight of 194.65 g/mol. Its IUPAC name is 6-chlorothieno[2,3-b]pyridine-5-carbonitrile.
Molecular Properties
| Compound Name | 6-chlorothieno[2,3-b]pyridine-5-carbonitrile |
| PubChem CID | 82400712 |
| Molecular Formula | C8H3ClN2S |
| Molecular Weight | 194.65 g/mol |
| Exact Mass | 193.97 |
| IUPAC Name | 6-chlorothieno[2,3-b]pyridine-5-carbonitrile |
| SMILES | N#Cc1cc2ccsc2nc1Cl |
| InChI | InChI=1S/C8H3ClN2S/c9-7-6(4-10)3-5-1-2-12-8(5)11-7/h1-3H |
| InChIKey | ZTZZMKDOWNJFNF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.65 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chlorothieno[2,3-b]pyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chlorothieno[2,3-b]pyridine-5-carbonitrile?
The IUPAC name of 6-chlorothieno[2,3-b]pyridine-5-carbonitrile (CID 82400712) is 6-chlorothieno[2,3-b]pyridine-5-carbonitrile.
What is the SMILES notation for 6-chlorothieno[2,3-b]pyridine-5-carbonitrile?
The canonical SMILES for 6-chlorothieno[2,3-b]pyridine-5-carbonitrile is N#Cc1cc2ccsc2nc1Cl.
What is the InChIKey of 6-chlorothieno[2,3-b]pyridine-5-carbonitrile?
The InChIKey is ZTZZMKDOWNJFNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3ClN2S/c9-7-6(4-10)3-5-1-2-12-8(5)11-7/h1-3H.
What are the key properties of 6-chlorothieno[2,3-b]pyridine-5-carbonitrile?
6-chlorothieno[2,3-b]pyridine-5-carbonitrile has a molecular weight of 194.65 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chlorothieno[2,3-b]pyridine-5-carbonitrile is sourced from PubChem (CID 82400712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).