C8H6Cl2N2 — CID 14211647
2,5-dichloro-6-ethylpyridine-3-carbonitrile (PubChem CID 14211647) has the molecular formula C8H6Cl2N2 and a molecular weight of 201.06 g/mol. Its IUPAC name is 2,5-dichloro-6-ethylpyridine-3-carbonitrile.
| Compound Name | 2,5-dichloro-6-ethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 14211647 |
| Molecular Formula | C8H6Cl2N2 |
| Molecular Weight | 201.06 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 2,5-dichloro-6-ethylpyridine-3-carbonitrile |
| SMILES | CCc1nc(Cl)c(C#N)cc1Cl |
| InChI | InChI=1S/C8H6Cl2N2/c1-2-7-6(9)3-5(4-11)8(10)12-7/h3H,2H2,1H3 |
| InChIKey | XGZXCAVMKPLDPM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.06 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|