C8H4ClN3S — CID 82394973
6-chloro-3-methyl-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile (PubChem CID 82394973) has the molecular formula C8H4ClN3S and a molecular weight of 209.66 g/mol. Its IUPAC name is 6-chloro-3-methyl-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile.
| Compound Name | 6-chloro-3-methyl-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 82394973 |
| Molecular Formula | C8H4ClN3S |
| Molecular Weight | 209.66 g/mol |
| Exact Mass | 208.98 |
| IUPAC Name | 6-chloro-3-methyl-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile |
| SMILES | Cc1nsc2nc(Cl)c(C#N)cc12 |
| InChI | InChI=1S/C8H4ClN3S/c1-4-6-2-5(3-10)7(9)11-8(6)13-12-4/h2H,1H3 |
| InChIKey | CJDMDBOMEBGXIJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.66 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|