C12H16ClNO — CID 117324460
O-[2-(4-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]hydroxylamine (PubChem CID 117324460) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is O-[2-(4-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]hydroxylamine.
| Compound Name | O-[2-(4-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117324460 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | O-[2-(4-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]hydroxylamine |
| SMILES | NOCCc1cc(Cl)c2c(c1)CCCC2 |
| InChI | InChI=1S/C12H16ClNO/c13-12-8-9(5-6-15-14)7-10-3-1-2-4-11(10)12/h7-8H,1-6,14H2 |
| InChIKey | UNUABSSRELYBJU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|