C10H12ClNO2 — CID 117304611
4-chloro-6-[(hydroxyamino)methyl]-2,3-dihydro-1H-inden-5-ol (PubChem CID 117304611) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is 4-chloro-6-[(hydroxyamino)methyl]-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 4-chloro-6-[(hydroxyamino)methyl]-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 117304611 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 4-chloro-6-[(hydroxyamino)methyl]-2,3-dihydro-1H-inden-5-ol |
| SMILES | ONCc1cc2c(c(Cl)c1O)CCC2 |
| InChI | InChI=1S/C10H12ClNO2/c11-9-8-3-1-2-6(8)4-7(5-12-14)10(9)13/h4,12-14H,1-3,5H2 |
| InChIKey | MMFGNUILLZQAND-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|