C7H6ClF2NO2 — CID 84780927
2-chloro-3,4-difluoro-6-[(hydroxyamino)methyl]phenol (PubChem CID 84780927) has the molecular formula C7H6ClF2NO2 and a molecular weight of 209.58 g/mol. Its IUPAC name is 2-chloro-3,4-difluoro-6-[(hydroxyamino)methyl]phenol.
| Compound Name | 2-chloro-3,4-difluoro-6-[(hydroxyamino)methyl]phenol |
|---|---|
| PubChem CID | 84780927 |
| Molecular Formula | C7H6ClF2NO2 |
| Molecular Weight | 209.58 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 2-chloro-3,4-difluoro-6-[(hydroxyamino)methyl]phenol |
| SMILES | ONCc1cc(F)c(F)c(Cl)c1O |
| InChI | InChI=1S/C7H6ClF2NO2/c8-5-6(10)4(9)1-3(2-11-13)7(5)12/h1,11-13H,2H2 |
| InChIKey | VDLXYDUOEAKXIO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.58 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|