C7H7F2NO2 — CID 117277165
2,6-difluoro-3-[(hydroxyamino)methyl]phenol (PubChem CID 117277165) has the molecular formula C7H7F2NO2 and a molecular weight of 175.13 g/mol. Its IUPAC name is 2,6-difluoro-3-[(hydroxyamino)methyl]phenol.
| Compound Name | 2,6-difluoro-3-[(hydroxyamino)methyl]phenol |
|---|---|
| PubChem CID | 117277165 |
| Molecular Formula | C7H7F2NO2 |
| Molecular Weight | 175.13 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | 2,6-difluoro-3-[(hydroxyamino)methyl]phenol |
| SMILES | ONCc1ccc(F)c(O)c1F |
| InChI | InChI=1S/C7H7F2NO2/c8-5-2-1-4(3-10-12)6(9)7(5)11/h1-2,10-12H,3H2 |
| InChIKey | VANPFIMWZIEBRE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.13 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|