C7H5BrF3NO — CID 117111115
N-[(4-bromo-2,3,5-trifluorophenyl)methyl]hydroxylamine (PubChem CID 117111115) has the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. Its IUPAC name is N-[(4-bromo-2,3,5-trifluorophenyl)methyl]hydroxylamine.
| Compound Name | N-[(4-bromo-2,3,5-trifluorophenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117111115 |
| Molecular Formula | C7H5BrF3NO |
| Molecular Weight | 256.02 g/mol |
| Exact Mass | 254.95 |
| IUPAC Name | N-[(4-bromo-2,3,5-trifluorophenyl)methyl]hydroxylamine |
| SMILES | ONCc1cc(F)c(Br)c(F)c1F |
| InChI | InChI=1S/C7H5BrF3NO/c8-5-4(9)1-3(2-12-13)6(10)7(5)11/h1,12-13H,2H2 |
| InChIKey | MVDBOQDACJPXPZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.02 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|