C7H7ClFNO3 — CID 117296925
5-chloro-4-fluoro-3-[(hydroxyamino)methyl]benzene-1,2-diol (PubChem CID 117296925) has the molecular formula C7H7ClFNO3 and a molecular weight of 207.59 g/mol. Its IUPAC name is 5-chloro-4-fluoro-3-[(hydroxyamino)methyl]benzene-1,2-diol.
| Compound Name | 5-chloro-4-fluoro-3-[(hydroxyamino)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 117296925 |
| Molecular Formula | C7H7ClFNO3 |
| Molecular Weight | 207.59 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | 5-chloro-4-fluoro-3-[(hydroxyamino)methyl]benzene-1,2-diol |
| SMILES | ONCc1c(O)c(O)cc(Cl)c1F |
| InChI | InChI=1S/C7H7ClFNO3/c8-4-1-5(11)7(12)3(2-10-13)6(4)9/h1,10-13H,2H2 |
| InChIKey | QRKQJEKVRCQLLA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.59 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|