C8H7ClFNO3 — CID 117313514
N-[(6-chloro-5-fluoro-1,3-benzodioxol-4-yl)methyl]hydroxylamine (PubChem CID 117313514) has the molecular formula C8H7ClFNO3 and a molecular weight of 219.60 g/mol. Its IUPAC name is N-[(6-chloro-5-fluoro-1,3-benzodioxol-4-yl)methyl]hydroxylamine.
| Compound Name | N-[(6-chloro-5-fluoro-1,3-benzodioxol-4-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117313514 |
| Molecular Formula | C8H7ClFNO3 |
| Molecular Weight | 219.60 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | N-[(6-chloro-5-fluoro-1,3-benzodioxol-4-yl)methyl]hydroxylamine |
| SMILES | ONCc1c(F)c(Cl)cc2c1OCO2 |
| InChI | InChI=1S/C8H7ClFNO3/c9-5-1-6-8(14-3-13-6)4(2-11-12)7(5)10/h1,11-12H,2-3H2 |
| InChIKey | KUNGCVKIHLWGLQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.60 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|