C9H10ClNO4 — CID 117335285
6-chloro-4-[(methoxyamino)methyl]-1,3-benzodioxol-5-ol (PubChem CID 117335285) has the molecular formula C9H10ClNO4 and a molecular weight of 231.63 g/mol. Its IUPAC name is 6-chloro-4-[(methoxyamino)methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-chloro-4-[(methoxyamino)methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 117335285 |
| Molecular Formula | C9H10ClNO4 |
| Molecular Weight | 231.63 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 6-chloro-4-[(methoxyamino)methyl]-1,3-benzodioxol-5-ol |
| SMILES | CONCc1c(O)c(Cl)cc2c1OCO2 |
| InChI | InChI=1S/C9H10ClNO4/c1-13-11-3-5-8(12)6(10)2-7-9(5)15-4-14-7/h2,11-12H,3-4H2,1H3 |
| InChIKey | ALRLRDCJKDWXTN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.63 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|