C10H12ClNO3 — CID 117331375
1-(6-chloro-4-methyl-1,3-benzodioxol-5-yl)-N-methoxymethanamine (PubChem CID 117331375) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is 1-(6-chloro-4-methyl-1,3-benzodioxol-5-yl)-N-methoxymethanamine.
| Compound Name | 1-(6-chloro-4-methyl-1,3-benzodioxol-5-yl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 117331375 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 1-(6-chloro-4-methyl-1,3-benzodioxol-5-yl)-N-methoxymethanamine |
| SMILES | CONCc1c(Cl)cc2c(c1C)OCO2 |
| InChI | InChI=1S/C10H12ClNO3/c1-6-7(4-12-13-2)8(11)3-9-10(6)15-5-14-9/h3,12H,4-5H2,1-2H3 |
| InChIKey | DJLZHCHWHDENCN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|