C10H12ClNO3 — CID 117331402
4-(2-aminopropan-2-yl)-6-chloro-1,3-benzodioxol-5-ol (PubChem CID 117331402) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is 4-(2-aminopropan-2-yl)-6-chloro-1,3-benzodioxol-5-ol.
| Compound Name | 4-(2-aminopropan-2-yl)-6-chloro-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 117331402 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 4-(2-aminopropan-2-yl)-6-chloro-1,3-benzodioxol-5-ol |
| SMILES | CC(C)(N)c1c(O)c(Cl)cc2c1OCO2 |
| InChI | InChI=1S/C10H12ClNO3/c1-10(2,12)7-8(13)5(11)3-6-9(7)15-4-14-6/h3,13H,4,12H2,1-2H3 |
| InChIKey | XFETZKWMAUFPQU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|