C8H7FO4 — CID 117280329
6-fluoro-7-(hydroxymethyl)-1,3-benzodioxol-5-ol (PubChem CID 117280329) has the molecular formula C8H7FO4 and a molecular weight of 186.14 g/mol. Its IUPAC name is 6-fluoro-7-(hydroxymethyl)-1,3-benzodioxol-5-ol.
| Compound Name | 6-fluoro-7-(hydroxymethyl)-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 117280329 |
| Molecular Formula | C8H7FO4 |
| Molecular Weight | 186.14 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 6-fluoro-7-(hydroxymethyl)-1,3-benzodioxol-5-ol |
| SMILES | OCc1c(F)c(O)cc2c1OCO2 |
| InChI | InChI=1S/C8H7FO4/c9-7-4(2-10)8-6(1-5(7)11)12-3-13-8/h1,10-11H,2-3H2 |
| InChIKey | CPLKLHYKQIVXPX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.14 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |