C9H9FO4 — CID 117289027
(5-fluoro-6-methoxy-1,3-benzodioxol-4-yl)methanol (PubChem CID 117289027) has the molecular formula C9H9FO4 and a molecular weight of 200.16 g/mol. Its IUPAC name is (5-fluoro-6-methoxy-1,3-benzodioxol-4-yl)methanol.
| Compound Name | (5-fluoro-6-methoxy-1,3-benzodioxol-4-yl)methanol |
|---|---|
| PubChem CID | 117289027 |
| Molecular Formula | C9H9FO4 |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | (5-fluoro-6-methoxy-1,3-benzodioxol-4-yl)methanol |
| SMILES | COc1cc2c(c(CO)c1F)OCO2 |
| InChI | InChI=1S/C9H9FO4/c1-12-6-2-7-9(14-4-13-7)5(3-11)8(6)10/h2,11H,3-4H2,1H3 |
| InChIKey | YQNXJMGXYHACJB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |