C11H10FN3O3 — CID 117380453
4-(5-fluoro-6-methoxy-1,3-benzodioxol-4-yl)-1H-pyrazol-5-amine (PubChem CID 117380453) has the molecular formula C11H10FN3O3 and a molecular weight of 251.22 g/mol. Its IUPAC name is 4-(5-fluoro-6-methoxy-1,3-benzodioxol-4-yl)-1H-pyrazol-5-amine.
| Compound Name | 4-(5-fluoro-6-methoxy-1,3-benzodioxol-4-yl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117380453 |
| Molecular Formula | C11H10FN3O3 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 4-(5-fluoro-6-methoxy-1,3-benzodioxol-4-yl)-1H-pyrazol-5-amine |
| SMILES | COc1cc2c(c(-c3cn[nH]c3N)c1F)OCO2 |
| InChI | InChI=1S/C11H10FN3O3/c1-16-6-2-7-10(18-4-17-7)8(9(6)12)5-3-14-15-11(5)13/h2-3H,4H2,1H3,(H3,13,14,15) |
| InChIKey | UENMOILJPKKMGX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |