C10H10FN3O3 — CID 117350062
3-(5-amino-1H-pyrazol-4-yl)-4-fluoro-5-methoxybenzene-1,2-diol (PubChem CID 117350062) has the molecular formula C10H10FN3O3 and a molecular weight of 239.21 g/mol. Its IUPAC name is 3-(5-amino-1H-pyrazol-4-yl)-4-fluoro-5-methoxybenzene-1,2-diol.
| Compound Name | 3-(5-amino-1H-pyrazol-4-yl)-4-fluoro-5-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 117350062 |
| Molecular Formula | C10H10FN3O3 |
| Molecular Weight | 239.21 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-(5-amino-1H-pyrazol-4-yl)-4-fluoro-5-methoxybenzene-1,2-diol |
| SMILES | COc1cc(O)c(O)c(-c2cn[nH]c2N)c1F |
| InChI | InChI=1S/C10H10FN3O3/c1-17-6-2-5(15)9(16)7(8(6)11)4-3-13-14-10(4)12/h2-3,15-16H,1H3,(H3,12,13,14) |
| InChIKey | WEVDQCWKAYVWIJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|