C9H6BrF2N3O — CID 117468094
4-(5-amino-1H-pyrazol-4-yl)-2-bromo-3,5-difluorophenol (PubChem CID 117468094) has the molecular formula C9H6BrF2N3O and a molecular weight of 290.07 g/mol. Its IUPAC name is 4-(5-amino-1H-pyrazol-4-yl)-2-bromo-3,5-difluorophenol.
| Compound Name | 4-(5-amino-1H-pyrazol-4-yl)-2-bromo-3,5-difluorophenol |
|---|---|
| PubChem CID | 117468094 |
| Molecular Formula | C9H6BrF2N3O |
| Molecular Weight | 290.07 g/mol |
| Exact Mass | 288.97 |
| IUPAC Name | 4-(5-amino-1H-pyrazol-4-yl)-2-bromo-3,5-difluorophenol |
| SMILES | Nc1[nH]ncc1-c1c(F)cc(O)c(Br)c1F |
| InChI | InChI=1S/C9H6BrF2N3O/c10-7-5(16)1-4(11)6(8(7)12)3-2-14-15-9(3)13/h1-2,16H,(H3,13,14,15) |
| InChIKey | GHZILLBZBIWZEW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.07 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|