C9H6BrF2N3 — CID 117437328
4-(2-bromo-4,5-difluorophenyl)-1H-pyrazol-5-amine (PubChem CID 117437328) has the molecular formula C9H6BrF2N3 and a molecular weight of 274.07 g/mol. Its IUPAC name is 4-(2-bromo-4,5-difluorophenyl)-1H-pyrazol-5-amine.
| Compound Name | 4-(2-bromo-4,5-difluorophenyl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117437328 |
| Molecular Formula | C9H6BrF2N3 |
| Molecular Weight | 274.07 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | 4-(2-bromo-4,5-difluorophenyl)-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1-c1cc(F)c(F)cc1Br |
| InChI | InChI=1S/C9H6BrF2N3/c10-6-2-8(12)7(11)1-4(6)5-3-14-15-9(5)13/h1-3H,(H3,13,14,15) |
| InChIKey | USFVSRWEMBWIJB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.07 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|