C13H14F2N4O — CID 115112119
4-(4,5-difluoro-2-morpholin-4-ylphenyl)-1H-pyrazol-5-amine (PubChem CID 115112119) has the molecular formula C13H14F2N4O and a molecular weight of 280.28 g/mol. Its IUPAC name is 4-(4,5-difluoro-2-morpholin-4-ylphenyl)-1H-pyrazol-5-amine.
| Compound Name | 4-(4,5-difluoro-2-morpholin-4-ylphenyl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 115112119 |
| Molecular Formula | C13H14F2N4O |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-(4,5-difluoro-2-morpholin-4-ylphenyl)-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1-c1cc(F)c(F)cc1N1CCOCC1 |
| InChI | InChI=1S/C13H14F2N4O/c14-10-5-8(9-7-17-18-13(9)16)12(6-11(10)15)19-1-3-20-4-2-19/h5-7H,1-4H2,(H3,16,17,18) |
| InChIKey | PSXMZPWOJRZVRX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |