C9H5ClF3N3 — CID 117372261
4-(3-chloro-2,4,6-trifluorophenyl)-1H-pyrazol-5-amine (PubChem CID 117372261) has the molecular formula C9H5ClF3N3 and a molecular weight of 247.61 g/mol. Its IUPAC name is 4-(3-chloro-2,4,6-trifluorophenyl)-1H-pyrazol-5-amine.
| Compound Name | 4-(3-chloro-2,4,6-trifluorophenyl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117372261 |
| Molecular Formula | C9H5ClF3N3 |
| Molecular Weight | 247.61 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 4-(3-chloro-2,4,6-trifluorophenyl)-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1-c1c(F)cc(F)c(Cl)c1F |
| InChI | InChI=1S/C9H5ClF3N3/c10-7-5(12)1-4(11)6(8(7)13)3-2-15-16-9(3)14/h1-2H,(H3,14,15,16) |
| InChIKey | QEMKDDWEVJTOFB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.61 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|