C10H9F2N3O2S — CID 117435379
4-(2,6-difluoro-3-methylsulfonylphenyl)-1H-pyrazol-5-amine (PubChem CID 117435379) has the molecular formula C10H9F2N3O2S and a molecular weight of 273.26 g/mol. Its IUPAC name is 4-(2,6-difluoro-3-methylsulfonylphenyl)-1H-pyrazol-5-amine.
| Compound Name | 4-(2,6-difluoro-3-methylsulfonylphenyl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117435379 |
| Molecular Formula | C10H9F2N3O2S |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 4-(2,6-difluoro-3-methylsulfonylphenyl)-1H-pyrazol-5-amine |
| SMILES | CS(=O)(=O)c1ccc(F)c(-c2cn[nH]c2N)c1F |
| InChI | InChI=1S/C10H9F2N3O2S/c1-18(16,17)7-3-2-6(11)8(9(7)12)5-4-14-15-10(5)13/h2-4H,1H3,(H3,13,14,15) |
| InChIKey | LEVDEFQCWGFQTJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |