C11H12FN3O3S — CID 117459290
4-(5-fluoro-2-methoxy-3-methylsulfonylphenyl)-1H-pyrazol-5-amine (PubChem CID 117459290) has the molecular formula C11H12FN3O3S and a molecular weight of 285.30 g/mol. Its IUPAC name is 4-(5-fluoro-2-methoxy-3-methylsulfonylphenyl)-1H-pyrazol-5-amine.
| Compound Name | 4-(5-fluoro-2-methoxy-3-methylsulfonylphenyl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117459290 |
| Molecular Formula | C11H12FN3O3S |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 4-(5-fluoro-2-methoxy-3-methylsulfonylphenyl)-1H-pyrazol-5-amine |
| SMILES | COc1c(-c2cn[nH]c2N)cc(F)cc1S(C)(=O)=O |
| InChI | InChI=1S/C11H12FN3O3S/c1-18-10-7(8-5-14-15-11(8)13)3-6(12)4-9(10)19(2,16)17/h3-5H,1-2H3,(H3,13,14,15) |
| InChIKey | VMNZCQFUUYZHNU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |