C13H15F2N3O2 — CID 117455217
4-[5-(1,1-difluoroethyl)-2,3-dimethoxyphenyl]-1H-pyrazol-5-amine (PubChem CID 117455217) has the molecular formula C13H15F2N3O2 and a molecular weight of 283.28 g/mol. Its IUPAC name is 4-[5-(1,1-difluoroethyl)-2,3-dimethoxyphenyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[5-(1,1-difluoroethyl)-2,3-dimethoxyphenyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117455217 |
| Molecular Formula | C13H15F2N3O2 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 4-[5-(1,1-difluoroethyl)-2,3-dimethoxyphenyl]-1H-pyrazol-5-amine |
| SMILES | COc1cc(C(C)(F)F)cc(-c2cn[nH]c2N)c1OC |
| InChI | InChI=1S/C13H15F2N3O2/c1-13(14,15)7-4-8(9-6-17-18-12(9)16)11(20-3)10(5-7)19-2/h4-6H,1-3H3,(H3,16,17,18) |
| InChIKey | VIXYXHNVMVOTOL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |