C11H11F2N3O — CID 117350162
4-[3-fluoro-5-(fluoromethyl)-2-methoxyphenyl]-1H-pyrazol-5-amine (PubChem CID 117350162) has the molecular formula C11H11F2N3O and a molecular weight of 239.22 g/mol. Its IUPAC name is 4-[3-fluoro-5-(fluoromethyl)-2-methoxyphenyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[3-fluoro-5-(fluoromethyl)-2-methoxyphenyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117350162 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 4-[3-fluoro-5-(fluoromethyl)-2-methoxyphenyl]-1H-pyrazol-5-amine |
| SMILES | COc1c(F)cc(CF)cc1-c1cn[nH]c1N |
| InChI | InChI=1S/C11H11F2N3O/c1-17-10-7(8-5-15-16-11(8)14)2-6(4-12)3-9(10)13/h2-3,5H,4H2,1H3,(H3,14,15,16) |
| InChIKey | NGJMISUXIJYGEA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |