C10H9F2N3 — CID 117298239
4-(2,6-difluoro-3-methylphenyl)-1H-pyrazol-5-amine (PubChem CID 117298239) has the molecular formula C10H9F2N3 and a molecular weight of 209.20 g/mol. Its IUPAC name is 4-(2,6-difluoro-3-methylphenyl)-1H-pyrazol-5-amine.
| Compound Name | 4-(2,6-difluoro-3-methylphenyl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117298239 |
| Molecular Formula | C10H9F2N3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 4-(2,6-difluoro-3-methylphenyl)-1H-pyrazol-5-amine |
| SMILES | Cc1ccc(F)c(-c2cn[nH]c2N)c1F |
| InChI | InChI=1S/C10H9F2N3/c1-5-2-3-7(11)8(9(5)12)6-4-14-15-10(6)13/h2-4H,1H3,(H3,13,14,15) |
| InChIKey | JKYGHULUADUQAZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |