C11H12ClN3 — CID 117317358
4-(6-chloro-2,3-dimethylphenyl)-1H-pyrazol-5-amine (PubChem CID 117317358) has the molecular formula C11H12ClN3 and a molecular weight of 221.69 g/mol. Its IUPAC name is 4-(6-chloro-2,3-dimethylphenyl)-1H-pyrazol-5-amine.
| Compound Name | 4-(6-chloro-2,3-dimethylphenyl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117317358 |
| Molecular Formula | C11H12ClN3 |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 4-(6-chloro-2,3-dimethylphenyl)-1H-pyrazol-5-amine |
| SMILES | Cc1ccc(Cl)c(-c2cn[nH]c2N)c1C |
| InChI | InChI=1S/C11H12ClN3/c1-6-3-4-9(12)10(7(6)2)8-5-14-15-11(8)13/h3-5H,1-2H3,(H3,13,14,15) |
| InChIKey | LHORYAXADDLHEK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |