C12H15N3O — CID 115112091
2-(5-amino-1H-pyrazol-4-yl)-3,5,6-trimethylphenol (PubChem CID 115112091) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-(5-amino-1H-pyrazol-4-yl)-3,5,6-trimethylphenol.
| Compound Name | 2-(5-amino-1H-pyrazol-4-yl)-3,5,6-trimethylphenol |
|---|---|
| PubChem CID | 115112091 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-(5-amino-1H-pyrazol-4-yl)-3,5,6-trimethylphenol |
| SMILES | Cc1cc(C)c(-c2cn[nH]c2N)c(O)c1C |
| InChI | InChI=1S/C12H15N3O/c1-6-4-7(2)10(11(16)8(6)3)9-5-14-15-12(9)13/h4-5,16H,1-3H3,(H3,13,14,15) |
| InChIKey | TZXQUYCNJZFEFB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |