C10H12BrNO2 — CID 58602618
2-bromo-1,3,4,5-tetrahydro-2-benzazepine-7,8-diol (PubChem CID 58602618) has the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. Its IUPAC name is 2-bromo-1,3,4,5-tetrahydro-2-benzazepine-7,8-diol.
| Compound Name | 2-bromo-1,3,4,5-tetrahydro-2-benzazepine-7,8-diol |
|---|---|
| PubChem CID | 58602618 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 2-bromo-1,3,4,5-tetrahydro-2-benzazepine-7,8-diol |
| SMILES | Oc1cc2c(cc1O)CN(Br)CCC2 |
| InChI | InChI=1S/C10H12BrNO2/c11-12-3-1-2-7-4-9(13)10(14)5-8(7)6-12/h4-5,13-14H,1-3,6H2 |
| InChIKey | DJOZEXDXTREPKO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|