C9H9BrClNO — CID 58602718
2-bromo-6-chloro-3,4-dihydro-1H-isoquinolin-7-ol (PubChem CID 58602718) has the molecular formula C9H9BrClNO and a molecular weight of 262.53 g/mol. Its IUPAC name is 2-bromo-6-chloro-3,4-dihydro-1H-isoquinolin-7-ol.
| Compound Name | 2-bromo-6-chloro-3,4-dihydro-1H-isoquinolin-7-ol |
|---|---|
| PubChem CID | 58602718 |
| Molecular Formula | C9H9BrClNO |
| Molecular Weight | 262.53 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | 2-bromo-6-chloro-3,4-dihydro-1H-isoquinolin-7-ol |
| SMILES | Oc1cc2c(cc1Cl)CCN(Br)C2 |
| InChI | InChI=1S/C9H9BrClNO/c10-12-2-1-6-3-8(11)9(13)4-7(6)5-12/h3-4,13H,1-2,5H2 |
| InChIKey | ZATIJXPUXHVXKE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|