C19H22ClNO3 — CID 139566514
2-[4-(4-chlorophenyl)-1-hydroxybutyl]-3,4-dihydro-1H-isoquinoline-6,7-diol (PubChem CID 139566514) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-1-hydroxybutyl]-3,4-dihydro-1H-isoquinoline-6,7-diol.
| Compound Name | 2-[4-(4-chlorophenyl)-1-hydroxybutyl]-3,4-dihydro-1H-isoquinoline-6,7-diol |
|---|---|
| PubChem CID | 139566514 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-1-hydroxybutyl]-3,4-dihydro-1H-isoquinoline-6,7-diol |
| SMILES | Oc1cc2c(cc1O)CN(C(O)CCCc1ccc(Cl)cc1)CC2 |
| InChI | InChI=1S/C19H22ClNO3/c20-16-6-4-13(5-7-16)2-1-3-19(24)21-9-8-14-10-17(22)18(23)11-15(14)12-21/h4-7,10-11,19,22-24H,1-3,8-9,12H2 |
| InChIKey | UPHGFJMIKIHELF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|