C18H18Cl2N2O2S — CID 11246492
N-[2-(3,4-dichlorophenyl)ethyl]-6,7-dihydroxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 11246492) has the molecular formula C18H18Cl2N2O2S and a molecular weight of 397.33 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)ethyl]-6,7-dihydroxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)ethyl]-6,7-dihydroxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 11246492 |
| Molecular Formula | C18H18Cl2N2O2S |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)ethyl]-6,7-dihydroxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | Oc1cc2c(cc1O)CN(C(=S)NCCc1ccc(Cl)c(Cl)c1)CC2 |
| InChI | InChI=1S/C18H18Cl2N2O2S/c19-14-2-1-11(7-15(14)20)3-5-21-18(25)22-6-4-12-8-16(23)17(24)9-13(12)10-22/h1-2,7-9,23-24H,3-6,10H2,(H,21,25) |
| InChIKey | VVSCJGLEMLVPNY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|