C10H12N2O2S — CID 130474626
6,7-dihydroxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 130474626) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 6,7-dihydroxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | 6,7-dihydroxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 130474626 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 6,7-dihydroxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | NC(=S)N1CCc2cc(O)c(O)cc2C1 |
| InChI | InChI=1S/C10H12N2O2S/c11-10(15)12-2-1-6-3-8(13)9(14)4-7(6)5-12/h3-4,13-14H,1-2,5H2,(H2,11,15) |
| InChIKey | IBSKKJGUZGRFFL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|