C11H16INO2 — CID 23621205
iodomethane;2-methyl-3,4-dihydro-1H-isoquinoline-6,7-diol (PubChem CID 23621205) has the molecular formula C11H16INO2 and a molecular weight of 321.16 g/mol. Its IUPAC name is iodomethane;2-methyl-3,4-dihydro-1H-isoquinoline-6,7-diol.
| Compound Name | iodomethane;2-methyl-3,4-dihydro-1H-isoquinoline-6,7-diol |
|---|---|
| PubChem CID | 23621205 |
| Molecular Formula | C11H16INO2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | iodomethane;2-methyl-3,4-dihydro-1H-isoquinoline-6,7-diol |
| SMILES | CI.CN1CCc2cc(O)c(O)cc2C1 |
| InChI | InChI=1S/C10H13NO2.CH3I/c1-11-3-2-7-4-9(12)10(13)5-8(7)6-11;1-2/h4-5,12-13H,2-3,6H2,1H3;1H3 |
| InChIKey | CRWJXWDEGBLMPG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|